cas: 33599-61-0 — see every product listed under this CAS number, including other names
2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid, 98% (CAS 33599-61-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226645-250MG |
| cas | 33599-61-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 378.01 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2070.12 Pln | |
| Fluorochem | 10g | 3507.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid (CAS 33599-61-0) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OAORYCZPERQARS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OAORYCZPERQARS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2CC(C(=O)O)N |
Computed by PubChem (NCBI)