cas: 27696-37-3 — see every product listed under this CAS number, including other names
2-Amino-3-chloro-4-methylbenzoic acid, 97% (CAS 27696-37-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690507-250MG |
| cas | 27696-37-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-chloro-4-methylbenzoic acid (CAS 27696-37-3) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-3-chloro-4-methylbenzoic acid. InChIKey: IRDSLZYXLQZMRI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-3-chloro-4-methylbenzoic acid |
| InChIKey | IRDSLZYXLQZMRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)N)Cl |
Computed by PubChem (NCBI)