cas: 5653-40-7 — see every product listed under this CAS number, including other names
2-Amino-4,5-dimethoxybenzoic Acid, >98.0%(HPLC)(T) (CAS 5653-40-7) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2013-10G |
| cas | 5653-40-7 |
| size | 10g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10g | 221.61 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-amino-4,5-dimethoxybenzoic acid (CAS 5653-40-7) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzoic acid. InChIKey: HJVAVGOPTDJYOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzoic acid |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)OC |
Computed by PubChem (NCBI)