cas: 5653-40-7 — see every product listed under this CAS number, including other names
2-Amino-4,5-dimethoxybenzoic acid, 98%, 98% (CAS 5653-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GEG-1kg |
| cas | 5653-40-7 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1442.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 194.00 Pln | |
| Chemat | 500g | 763.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-4,5-dimethoxybenzoic acid (CAS 5653-40-7) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzoic acid. InChIKey: HJVAVGOPTDJYOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzoic acid |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)OC |
Computed by PubChem (NCBI)