cas: 5653-40-7 — see every product listed under this CAS number, including other names
2-Amino-4,5-dimethoxybenzoic acid, 98% (CAS 5653-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 5g, 500g, 10g, 1kg. Offered by: Combi-blocks, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-0028-100g |
| cas | 5653-40-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 500g | price on request | |
| Thermo Scientific (Acros) | 5g | 111.81 Pln | |
| Thermo Scientific (Acros) | 25g | 324.73 Pln | |
| Thermo Scientific (Acros) | 100g | 824.07 Pln | |
| Sigma-Aldrich | 5G | 237.00 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 258.26 Pln | |
| Fluorochem | 500g | 893.45 Pln | |
| Fluorochem | 1kg | 1731.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-amino-4,5-dimethoxybenzoic acid (CAS 5653-40-7) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzoic acid. InChIKey: HJVAVGOPTDJYOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzoic acid |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)OC |
Computed by PubChem (NCBI)