cas: 155184-81-9 — see every product listed under this CAS number, including other names
2-Amino-4-chloro-5-methylbenzoic acid 97% (CAS 155184-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755670-100mg |
| cas | 155184-81-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 2000.19 Pln | |
| Ambeed | 5g | 5849.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755670 |
2-amino-4-chloro-5-methylbenzoic acid (CAS 155184-81-9) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-4-chloro-5-methylbenzoic acid. InChIKey: FDCMZVNLUFYRAI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-4-chloro-5-methylbenzoic acid |
| InChIKey | FDCMZVNLUFYRAI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)N)C(=O)O |
Computed by PubChem (NCBI)