cas: 442134-72-7 — see every product listed under this CAS number, including other names
2-Amino-5,6-difluorobenzoic acid (CAS 442134-72-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065827-250MG |
| cas | 442134-72-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1112.13 Pln | |
| Fluorochem | 1g | 2861.51 Pln | |
| Fluorochem | 5g | 10671.26 Pln |
| delivery time | 2-3 weeks |
|---|
6-amino-2,3-difluorobenzoic acid (CAS 442134-72-7) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 6-amino-2,3-difluorobenzoic acid. InChIKey: CKPWBLHHQXCINB-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 6-amino-2,3-difluorobenzoic acid |
| InChIKey | CKPWBLHHQXCINB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)F |
Computed by PubChem (NCBI)