cas: 442134-72-7 — see every product listed under this CAS number, including other names
6-Amino-2,3-difluorobenzoic acid, 98%, 98% (CAS 442134-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEL9-100mg |
| cas | 442134-72-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1566.80 Pln | |
| Chemat | 5g | 4590.80 Pln | |
| Chemat | 500mg | 1274.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-amino-2,3-difluorobenzoic acid (CAS 442134-72-7) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 6-amino-2,3-difluorobenzoic acid. InChIKey: CKPWBLHHQXCINB-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 6-amino-2,3-difluorobenzoic acid |
| InChIKey | CKPWBLHHQXCINB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)F |
Computed by PubChem (NCBI)