cas: 934426-22-9 — see every product listed under this CAS number, including other names
2-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile 97% (CAS 934426-22-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A505090-100mg |
| cas | 934426-22-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 25g | 3863.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A505090 |
2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 934426-22-9) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: JWCNIIZUTIYXTL-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | JWCNIIZUTIYXTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)C#N |
Computed by PubChem (NCBI)