2-Amino-5-Phenylpentanoic Acid, 97%
cas: 34993-02-7 — see every product listed under this CAS number, including other names
2-Amino-5-Phenylpentanoic Acid, 97% (CAS 34993-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1130LG-100mg |
| cas | 34993-02-7 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1787.60 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1780.51 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 903.87 Pln | |
| Fluorochem | 5g | 3298.86 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-phenylpentanoic acid (CAS 34993-02-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-amino-5-phenylpentanoic acid. InChIKey: XOQZTHUXZWQXOK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-amino-5-phenylpentanoic acid |
| InChIKey | XOQZTHUXZWQXOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-5-phenylpentanoic acid, D-2-Amino-5-phenylpentanoic acid, Benzenepentanoic acid, alpha-amino-, 2-amino-5-phenyl-pentanoic acid, Benzenepentanoic acid, |A-amino-, 5-Phenylnorvaline, D-Nva(5-phenyl)-OH, 2-amino-5-phenylpentanoicacid, L-2-Amino-5-phenylpentanoic acid, L-Nva(5-phenyl)-OH