CAS 36061-08-2 appears in our catalog under these names: (R)–2–Amino–5–phenylpentanoic acid, (R)-2-Amino-5-phenylpentanoic acid, 98%, Benzenepentanoic acid, α-amino-, (αR)-, ≥98%, ≥98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-amino-5-phenylpentanoic acid (CAS 36061-08-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2R)-2-amino-5-phenylpentanoic acid. InChIKey: XOQZTHUXZWQXOK-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2R)-2-amino-5-phenylpentanoic acid |
| InChIKey | XOQZTHUXZWQXOK-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)