cas: 2639626-74-5 — see every product listed under this CAS number, including other names
2-Amino-5-bromo-3-pyridinyl 1,1-dimethylethyl carbonate, 97%, 97% (CAS 2639626-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1F2C02-100mg |
| cas | 2639626-74-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1509.20 Pln | |
| Chemat | 5g | 4610.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate (CAS 2639626-74-5) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate. InChIKey: WPKNMNOMYHLDBJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate |
| InChIKey | WPKNMNOMYHLDBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)