cas: 2639626-74-5 — see every product listed under this CAS number, including other names
2-Amino-5-bromo-3-pyridinyl 1,1-dimethylethyl carbonate, 98% (CAS 2639626-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F567455-100MG |
| cas | 2639626-74-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 976.76 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 5850.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate (CAS 2639626-74-5) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate. InChIKey: WPKNMNOMYHLDBJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | (2-amino-5-bromo-3-pyridinyl) tert-butyl carbonate |
| InChIKey | WPKNMNOMYHLDBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)