2-Amino-5-chloro-3-nitrobenzoic acid, 98%
cas: 6324-51-2 — see every product listed under this CAS number, including other names
2-Amino-5-chloro-3-nitrobenzoic acid, 98% (CAS 6324-51-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1271993-100mg |
| cas | 6324-51-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1227.00 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1319.56 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1202.00 Pln | |
| Fluorochem | 1g | 2231.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-5-chloro-3-nitrobenzoic acid (CAS 6324-51-2) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 2-amino-5-chloro-3-nitrobenzoic acid. InChIKey: BKTMGBPFFCRHST-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 2-amino-5-chloro-3-nitrobenzoic acid |
| InChIKey | BKTMGBPFFCRHST-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)