cas: 1850312-96-7 — see every product listed under this CAS number, including other names
2-Amino-5-fluoro-4-nitrophenol, 97% (CAS 1850312-96-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546241-100MG |
| cas | 1850312-96-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 4001.73 Pln | |
| Fluorochem | 10g | 7943.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-5-fluoro-4-nitrophenol (CAS 1850312-96-7) is a chemical compound with the molecular formula C6H5FN2O3 and a molecular weight of 172.11 g/mol. IUPAC name: 2-amino-5-fluoro-4-nitrophenol. InChIKey: FXJPJHWARSJNGF-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O3 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 2-amino-5-fluoro-4-nitrophenol |
| InChIKey | FXJPJHWARSJNGF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)O)N |
Computed by PubChem (NCBI)