Products 1936190-55-4

CAS 1936190-55-4 is the registry number for 5-Fluoro-6-methoxypyrimidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-fluoro-6-methoxypyrimidine-4-carboxylic acid (CAS 1936190-55-4) is a chemical compound with the molecular formula C6H5FN2O3 and a molecular weight of 172.11 g/mol. IUPAC name: 5-fluoro-6-methoxypyrimidine-4-carboxylic acid. InChIKey: TZVXLXQBWRZBHT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5FN2O3
Molecular weight172.11 g/mol
IUPAC name5-fluoro-6-methoxypyrimidine-4-carboxylic acid
InChIKeyTZVXLXQBWRZBHT-UHFFFAOYSA-N
SMILESCOC1=NC=NC(=C1F)C(=O)O

Computed by PubChem (NCBI)