CAS 1616526-85-2 appears in our catalog under these names: 5-Fluoro-1-methyl-3-nitropyridin-2(1h)-one, 95%, 5-Fluoro-1-methyl-3-nitropyridin-2(1H)-one 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
5-fluoro-1-methyl-3-nitropyridin-2-one (CAS 1616526-85-2) is a chemical compound with the molecular formula C6H5FN2O3 and a molecular weight of 172.11 g/mol. IUPAC name: 5-fluoro-1-methyl-3-nitropyridin-2-one. InChIKey: WTGWOLKLHVCEOJ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O3 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 5-fluoro-1-methyl-3-nitropyridin-2-one |
| InChIKey | WTGWOLKLHVCEOJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)