CAS 1211528-10-7 is the registry number for 5-Fluoro-3-methoxy-2-nitropyridine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
5-fluoro-3-methoxy-2-nitropyridine (CAS 1211528-10-7) is a chemical compound with the molecular formula C6H5FN2O3 and a molecular weight of 172.11 g/mol. IUPAC name: 5-fluoro-3-methoxy-2-nitropyridine. InChIKey: WPLJARUJRAFCDY-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O3 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 5-fluoro-3-methoxy-2-nitropyridine |
| InChIKey | WPLJARUJRAFCDY-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)