CAS 2090544-17-3 is the registry number for 5-Amino-2-fluoro-4-nitrophenol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-amino-2-fluoro-4-nitrophenol (CAS 2090544-17-3) is a chemical compound with the molecular formula C6H5FN2O3 and a molecular weight of 172.11 g/mol. IUPAC name: 5-amino-2-fluoro-4-nitrophenol. InChIKey: PDSQJRWWUUXOQL-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O3 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | 5-amino-2-fluoro-4-nitrophenol |
| InChIKey | PDSQJRWWUUXOQL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)