cas: 4214-76-0 — see every product listed under this CAS number, including other names
2-Amino-5-nitropyridine 98% (CAS 4214-76-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174828-10g |
| cas | 4214-76-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 553.94 Pln | |
| Ambeed | 1000g | 1021.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174828 |
5-nitropyridin-2-amine (CAS 4214-76-0) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 5-nitropyridin-2-amine. InChIKey: UGSBCCAHDVCHGI-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 5-nitropyridin-2-amine |
| InChIKey | UGSBCCAHDVCHGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)