cas: 4214-76-0 — see every product listed under this CAS number, including other names
2-Amino-5-nitropyridine, 98%, 98% (CAS 4214-76-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GHM-10g |
| cas | 4214-76-0 |
| size | 10g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 117.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitropyridin-2-amine (CAS 4214-76-0) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 5-nitropyridin-2-amine. InChIKey: UGSBCCAHDVCHGI-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 5-nitropyridin-2-amine |
| InChIKey | UGSBCCAHDVCHGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)