cas: 4214-76-0 — see every product listed under this CAS number, including other names
2-Amino-5-nitropyridine, 99% (CAS 4214-76-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 104230050 |
| cas | 4214-76-0 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 105.57 Pln | |
| Thermo Scientific (Acros) | 25g | 241.43 Pln | |
| Thermo Scientific (Acros) | 100g | 663.71 Pln | |
| Thermo Scientific (Acros) | 250g | 1403.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
5-nitropyridin-2-amine (CAS 4214-76-0) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 5-nitropyridin-2-amine. InChIKey: UGSBCCAHDVCHGI-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 5-nitropyridin-2-amine |
| InChIKey | UGSBCCAHDVCHGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)