cas: 4815-34-3 — see every product listed under this CAS number, including other names
2-Amino-5-phenyl-thiophene-3-carboxylic acid ethyl ester, 97% (CAS 4815-34-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021449-1G |
| cas | 4815-34-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 25g | 2502.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-5-phenylthiophene-3-carboxylate (CAS 4815-34-3) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-amino-5-phenylthiophene-3-carboxylate. InChIKey: WIVNPGXPJBBZQH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | ethyl 2-amino-5-phenylthiophene-3-carboxylate |
| InChIKey | WIVNPGXPJBBZQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)