cas: 4815-34-3 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-phenylthiophene-3-carboxylate, 98%, 98% (CAS 4815-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117X3F-100g |
| cas | 4815-34-3 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 4720.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 458.00 Pln | |
| Chemat | 25g | 1518.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-5-phenylthiophene-3-carboxylate (CAS 4815-34-3) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-amino-5-phenylthiophene-3-carboxylate. InChIKey: WIVNPGXPJBBZQH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | ethyl 2-amino-5-phenylthiophene-3-carboxylate |
| InChIKey | WIVNPGXPJBBZQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)