cas: 13535-13-2 — see every product listed under this CAS number, including other names
2-Amino-5-phenylpyrazine, >98.0%(GC) (CAS 13535-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1684-1G |
| cas | 13535-13-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 275.70 Pln | |
| TCI | 5g | 914.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
5-phenylpyrazin-2-amine (CAS 13535-13-2) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyrazin-2-amine. InChIKey: KJAKXVBZQBPPOB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyrazin-2-amine |
| InChIKey | KJAKXVBZQBPPOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=N2)N |
Computed by PubChem (NCBI)