CAS 13535-13-2 appears in our catalog under these names: 2–Amino–5–phenylpyrazine, 2-Amino-5-phenylpyrazine, 98%, 2-Amino-5-phenylpyrazine, 97+% , 2-Amino-5-phenylpyrazine, 98+%, 2-Amino-5-phenylpyrazine, >98.0%(GC). Offered by: GLPBio, Combi-blocks, Thermo Scientific, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
5-phenylpyrazin-2-amine (CAS 13535-13-2) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-phenylpyrazin-2-amine. InChIKey: KJAKXVBZQBPPOB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-phenylpyrazin-2-amine |
| InChIKey | KJAKXVBZQBPPOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=N2)N |
Computed by PubChem (NCBI)