CAS 41270-67-1 appears in our catalog under these names: 3-Phenylpyrazin-2-amine, 95%, 3-Phenylpyrazin-2-amine, 3-Phenylpyrazin-2-amine 95%, 3-Phenylpyrazin-2-amine, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 50mg, 500mg.
3-phenylpyrazin-2-amine (CAS 41270-67-1) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 3-phenylpyrazin-2-amine. InChIKey: HZNLSEFDJFDNFU-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 3-phenylpyrazin-2-amine |
| InChIKey | HZNLSEFDJFDNFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CN=C2N |
Computed by PubChem (NCBI)