CAS 1245745-55-4 appears in our catalog under these names: [2,3'-Bipyridin]-5'-amine, 95%, (2,3'-Bipyridin)-5'-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-pyridin-2-ylpyridin-3-amine (CAS 1245745-55-4) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 5-pyridin-2-ylpyridin-3-amine. InChIKey: RSKMKJSRFVPLBR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 5-pyridin-2-ylpyridin-3-amine |
| InChIKey | RSKMKJSRFVPLBR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CN=C2)N |
Computed by PubChem (NCBI)