CAS 35989-06-1 appears in our catalog under these names: 6-(Pyridin-3-yl)pyridin-3-amine, 95%, 6–(Pyridin–3–yl)pyridin–3–amine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
6-pyridin-3-ylpyridin-3-amine (CAS 35989-06-1) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 6-pyridin-3-ylpyridin-3-amine. InChIKey: PAQALCKYBOJWEA-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 6-pyridin-3-ylpyridin-3-amine |
| InChIKey | PAQALCKYBOJWEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)