cas: 311310-97-1 — see every product listed under this CAS number, including other names
2-Amino-6-(methoxycarbonyl)benzoic acid hydrochloride 97% (CAS 311310-97-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638333-250mg |
| cas | 311310-97-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A638333 |
2-amino-6-methoxycarbonylbenzoic acid;hydrochloride (CAS 311310-97-1) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride. InChIKey: VDKKHVAEYCYZSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride |
| InChIKey | VDKKHVAEYCYZSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)