cas: 311310-97-1 — see every product listed under this CAS number, including other names
2-Amino-6-(methoxycarbonyl)benzoic acid hydrochloride, 97%, 97% (CAS 311310-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GHV-100mg |
| cas | 311310-97-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1216.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-6-methoxycarbonylbenzoic acid;hydrochloride (CAS 311310-97-1) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride. InChIKey: VDKKHVAEYCYZSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride |
| InChIKey | VDKKHVAEYCYZSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)