cas: 923010-68-8 — see every product listed under this CAS number, including other names
2-Amino-6-(tert-butoxycarbonyl)-4,5,6,7-tetrahydrothieno-[2,3-c]-pyridine-3-carboxylic acid, 97% (CAS 923010-68-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043898-100MG |
| cas | 923010-68-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 955.93 Pln | |
| Fluorochem | 5g | 1643.19 Pln | |
| Fluorochem | 10g | 2502.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid (CAS 923010-68-8) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 2-amino-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid. InChIKey: YNNBGBZGUCLCAC-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2-amino-6-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
| InChIKey | YNNBGBZGUCLCAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2C(=O)O)N |
Computed by PubChem (NCBI)