cas: 106429-08-7 — see every product listed under this CAS number, including other names
2-Aminobenzothiazole-6-carboxaldehyde, 97%, 97% (CAS 106429-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104M3-100mg |
| cas | 106429-08-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1662.80 Pln | |
| Chemat | 5g | 2742.80 Pln | |
| Chemat | 10g | 4888.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-1,3-benzothiazole-6-carbaldehyde (CAS 106429-08-7) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 2-amino-1,3-benzothiazole-6-carbaldehyde. InChIKey: DCNYZCPMDDDDLR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazole-6-carbaldehyde |
| InChIKey | DCNYZCPMDDDDLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)SC(=N2)N |
Computed by PubChem (NCBI)