cas: 1365639-13-9 — see every product listed under this CAS number, including other names
2-Azaspiro[3.3]heptane oxalate(2:1), 97%, 97% (CAS 1365639-13-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112335-100mg |
| cas | 1365639-13-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 25g | 1278.80 Pln | |
| Chemat | 500mg | 112.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(2-azaspiro[3.3]heptane);oxalic acid (CAS 1365639-13-9) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: bis(2-azaspiro[3.3]heptane);oxalic acid. InChIKey: BNWFMJVKAIJDRK-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | bis(2-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | BNWFMJVKAIJDRK-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC2.C1CC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)