cas: 1365639-13-9 — see every product listed under this CAS number, including other names
2-Azaspiro[3.3]heptane, hemioxalate 98% (CAS 1365639-13-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329551-250mg |
| cas | 1365639-13-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A329551 |
Bis(2-azaspiro[3.3]heptane);oxalic acid (CAS 1365639-13-9) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: bis(2-azaspiro[3.3]heptane);oxalic acid. InChIKey: BNWFMJVKAIJDRK-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | bis(2-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | BNWFMJVKAIJDRK-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC2.C1CC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)