cas: 29198-43-4 — see every product listed under this CAS number, including other names
2-Benzothiazolecarboxamide, 97% (CAS 29198-43-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F433637-250MG |
| cas | 29198-43-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2049.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,3-benzothiazole-2-carboxamide (CAS 29198-43-4) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 1,3-benzothiazole-2-carboxamide. InChIKey: LYASTVLDAJIXBL-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1,3-benzothiazole-2-carboxamide |
| InChIKey | LYASTVLDAJIXBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(=O)N |
Computed by PubChem (NCBI)