cas: 1394840-24-4 — see every product listed under this CAS number, including other names
2-Benzyl-2,6-diazaspiro(3.3)heptane oxalate, 97% (CAS 1394840-24-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A706652-5g |
| cas | 1394840-24-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8956.15 Pln | |
| AmBeed | 10g | 14880.25 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid (CAS 1394840-24-4) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid. InChIKey: DOBOTFSJYCPDOS-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-benzyl-2,6-diazaspiro[3.3]heptane;oxalic acid |
| InChIKey | DOBOTFSJYCPDOS-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)