2-Benzylmalonic acid 98%
cas: 616-75-1 — see every product listed under this CAS number, including other names
2-Benzylmalonic acid 98% (CAS 616-75-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669341-1g |
| cas | 616-75-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 776.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A669341 |
2-benzylpropanedioic acid (CAS 616-75-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-benzylpropanedioic acid. InChIKey: JAEJSNFTJMYIEF-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-benzylpropanedioic acid |
| InChIKey | JAEJSNFTJMYIEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)