cas: 616-75-1 — see every product listed under this CAS number, including other names
2-Benzylmalonic acid, 98%, 98% (CAS 616-75-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GL8-1g |
| cas | 616-75-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1451.60 Pln | |
| Chemat | 50g | 774.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-benzylpropanedioic acid (CAS 616-75-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-benzylpropanedioic acid. InChIKey: JAEJSNFTJMYIEF-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-benzylpropanedioic acid |
| InChIKey | JAEJSNFTJMYIEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)