CAS 6272-38-4 appears in our catalog under these names: 2-(Benzyloxy)phenol, min. 95 %, 100 g, 2-(Benzyloxy)phenol, 2-Benzyloxyphenol, 98% , 2-(Benzyloxy)phenol, >97.0%(GC), 2-(Benzyloxy)phenol 98%. Offered by: Roth, TRC, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 10g, 1g, 5g, 25g, 50g, 250g, 500g.
2-phenylmethoxyphenol (CAS 6272-38-4) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-phenylmethoxyphenol. InChIKey: CCZCXFHJMKINPE-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-phenylmethoxyphenol |
| InChIKey | CCZCXFHJMKINPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2O |
Computed by PubChem (NCBI)