cas: 869976-20-5 — see every product listed under this CAS number, including other names
2-Boc-2,8-Diazaspiro[4.5]decane hydrochloride, 99%, 99% (CAS 869976-20-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147D1-1g |
| cas | 869976-20-5 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 870.80 Pln | |
| Chemat | 5g | 2656.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride (CAS 869976-20-5) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride. InChIKey: KNIAXYMLCVFVTK-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-2-carboxylate;hydrochloride |
| InChIKey | KNIAXYMLCVFVTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCNCC2.Cl |
Computed by PubChem (NCBI)