cas: 22019-50-7 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-methyl-3-nitro-phenyl)-ethanone, 97%, 97% (CAS 22019-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C250-100mg |
| cas | 22019-50-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1346.00 Pln | |
| Chemat | 1g | 2104.40 Pln | |
| Chemat | 5g | 7149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(4-methyl-3-nitrophenyl)ethanone (CAS 22019-50-7) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 2-bromo-1-(4-methyl-3-nitrophenyl)ethanone. InChIKey: DBMCVOBHUPAOMT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 2-bromo-1-(4-methyl-3-nitrophenyl)ethanone |
| InChIKey | DBMCVOBHUPAOMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)