cas: 210832-85-2 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-morpholinophenyl)-1-ethanone, 95% (CAS 210832-85-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC17405CB |
| cas | 210832-85-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 590.53 Pln | |
| Thermo Scientific | 1g | 621.08 Pln | |
| Thermo Scientific | 5g | 2463.95 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
2-bromo-1-(4-morpholin-4-ylphenyl)ethanone (CAS 210832-85-2) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 2-bromo-1-(4-morpholin-4-ylphenyl)ethanone. InChIKey: OUGMZFJPRSTGMJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 2-bromo-1-(4-morpholin-4-ylphenyl)ethanone |
| InChIKey | OUGMZFJPRSTGMJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)