CAS 1257664-97-3 is the registry number for 5-Bromo-2-(pyrrolidinocarbonyl)anisole, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
(4-bromo-2-methoxyphenyl)-pyrrolidin-1-ylmethanone (CAS 1257664-97-3) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: (4-bromo-2-methoxyphenyl)-pyrrolidin-1-ylmethanone. InChIKey: VBRHKYBMZIGYMK-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | (4-bromo-2-methoxyphenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | VBRHKYBMZIGYMK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)C(=O)N2CCCC2 |
Computed by PubChem (NCBI)