CAS 1807028-02-9 is the registry number for 2-Bromo-3-chloro-4-fluorobenzaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-3-chloro-4-fluorobenzaldehyde (CAS 1807028-02-9) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-3-chloro-4-fluorobenzaldehyde. InChIKey: VFRJZLULJYUFPP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-3-chloro-4-fluorobenzaldehyde |
| InChIKey | VFRJZLULJYUFPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Br)Cl)F |
Computed by PubChem (NCBI)