CAS 672-75-3 appears in our catalog under these names: 3-bromo-4-fluorobenzoylchloride, 98%, 3-Bromo-4-fluorobenzoyl chloride, 97%, 3-Bromo-4-fluoro-benzoyl chloride. Offered by: AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
3-bromo-4-fluorobenzoyl chloride (CAS 672-75-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 3-bromo-4-fluorobenzoyl chloride. InChIKey: HPHZOCIBMCWXCQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 3-bromo-4-fluorobenzoyl chloride |
| InChIKey | HPHZOCIBMCWXCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)Br)F |
Computed by PubChem (NCBI)