Products 1020718-20-0

CAS 1020718-20-0 appears in our catalog under these names: 2-Bromo-6-fluorobenzoyl chloride, 95%, 2–Bromo–6–fluorobenzoyl chloride, 2-Bromo-6-fluorobenzoyl chloride 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-bromo-6-fluorobenzoyl chloride (CAS 1020718-20-0) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-6-fluorobenzoyl chloride. InChIKey: ZQOQNOOLDFFUDH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClFO
Molecular weight237.45 g/mol
IUPAC name2-bromo-6-fluorobenzoyl chloride
InChIKeyZQOQNOOLDFFUDH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Br)C(=O)Cl)F

Computed by PubChem (NCBI)