CAS 151982-51-3 appears in our catalog under these names: 4-Bromo-2-fluorobenzoyl chloride, 97%, 4–Bromo–2–fluorobenzoyl chloride, 4-Bromo-2-fluorobenzoyl chloride, 98% , 4-Bromo-2-fluorobenzoyl Chloride, >98.0%(GC)(T), 4-Bromo-2-fluorobenzoyl chloride, 99%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 500g, 5g, 1g, 10g, 250mg.
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)