CAS 695188-21-7 appears in our catalog under these names: 4-Bromo-3-fluorobenzoyl chloride, 95%, 4-Bromo-3-fluorobenzoyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
4-bromo-3-fluorobenzoyl chloride (CAS 695188-21-7) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-3-fluorobenzoyl chloride. InChIKey: QKNNWDFHKRIYJH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-3-fluorobenzoyl chloride |
| InChIKey | QKNNWDFHKRIYJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)F)Br |
Computed by PubChem (NCBI)