cas: 2138894-45-6 — see every product listed under this CAS number, including other names
2-Bromo-4,5-dimethylphenylboronic acid (CAS 2138894-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627365-1G |
| cas | 2138894-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1382.86 Pln |
| delivery time | 3-4 weeks |
|---|
(2-bromo-4,5-dimethylphenyl)boronic acid (CAS 2138894-45-6) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (2-bromo-4,5-dimethylphenyl)boronic acid. InChIKey: GQIKWHOKUNTVBM-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (2-bromo-4,5-dimethylphenyl)boronic acid |
| InChIKey | GQIKWHOKUNTVBM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)C)C)(O)O |
Computed by PubChem (NCBI)